C13H12Cl2N4O — CID 170548700
[3-(2,4-dichlorophenyl)pyrrolidin-1-yl]-(2H-triazol-4-yl)methanone (PubChem CID 170548700) has the molecular formula C13H12Cl2N4O and a molecular weight of 311.17 g/mol. Its IUPAC name is [3-(2,4-dichlorophenyl)pyrrolidin-1-yl]-(2H-triazol-4-yl)methanone.
| Compound Name | [3-(2,4-dichlorophenyl)pyrrolidin-1-yl]-(2H-triazol-4-yl)methanone |
|---|---|
| PubChem CID | 170548700 |
| Molecular Formula | C13H12Cl2N4O |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | [3-(2,4-dichlorophenyl)pyrrolidin-1-yl]-(2H-triazol-4-yl)methanone |
| SMILES | O=C(c1cn[nH]n1)N1CCC(c2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C13H12Cl2N4O/c14-9-1-2-10(11(15)5-9)8-3-4-19(7-8)13(20)12-6-16-18-17-12/h1-2,5-6,8H,3-4,7H2,(H,16,17,18) |
| InChIKey | UMMYYFHKLBTKHM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |