C12H25N3O — CID 170549396
2-[4-(aminomethyl)piperidin-1-yl]-2,2-dideuterio-N-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]acetamide (PubChem CID 170549396) has the molecular formula C12H25N3O and a molecular weight of 238.42 g/mol. Its IUPAC name is 2-[4-(aminomethyl)piperidin-1-yl]-2,2-dideuterio-N-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]acetamide.
| Compound Name | 2-[4-(aminomethyl)piperidin-1-yl]-2,2-dideuterio-N-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 170549396 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.27 |
| IUPAC Name | 2-[4-(aminomethyl)piperidin-1-yl]-2,2-dideuterio-N-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]acetamide |
| SMILES | [2H]C([2H])(C(=O)NC(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])N1CCC(CN)CC1 |
| InChI | InChI=1S/C12H25N3O/c1-12(2,3)14-11(16)9-15-6-4-10(8-13)5-7-15/h10H,4-9,13H2,1-3H3,(H,14,16)/i1D3,2D3,3D3,9D2 |
| InChIKey | HLSDBOMELIRZRY-VTSFGHEDSA-N |
| XLogP | 0.57 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |