C12H21N3O — CID 170549393
2-(4-cyanopiperidin-1-yl)-N-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]acetamide (PubChem CID 170549393) has the molecular formula C12H21N3O and a molecular weight of 232.37 g/mol. Its IUPAC name is 2-(4-cyanopiperidin-1-yl)-N-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]acetamide.
| Compound Name | 2-(4-cyanopiperidin-1-yl)-N-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 170549393 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 2-(4-cyanopiperidin-1-yl)-N-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]acetamide |
| SMILES | [2H]C([2H])([2H])C(NC(=O)CN1CCC(C#N)CC1)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C12H21N3O/c1-12(2,3)14-11(16)9-15-6-4-10(8-13)5-7-15/h10H,4-7,9H2,1-3H3,(H,14,16)/i1D3,2D3,3D3 |
| InChIKey | YJPNUFUZDZWBFG-GQALSZNTSA-N |
| XLogP | 1.14 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |