About CID 59303846
CID 59303846 (PubChem CID 59303846) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol.
Molecular Properties
| Compound Name | CID 59303846 |
| PubChem CID | 59303846 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | — |
| SMILES | [CH]C(=O)CN1CCC(C#N)CC1 |
| InChI | InChI=1S/C9H12N2O/c1-8(12)7-11-4-2-9(6-10)3-5-11/h1,9H,2-5,7H2 |
| InChIKey | SBMDAQORXORLTK-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 59303846 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59303846?
The IUPAC name of CID 59303846 (CID 59303846) is not available.
What is the SMILES notation for CID 59303846?
The canonical SMILES for CID 59303846 is [CH]C(=O)CN1CCC(C#N)CC1.
What is the InChIKey of CID 59303846?
The InChIKey is SBMDAQORXORLTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-8(12)7-11-4-2-9(6-10)3-5-11/h1,9H,2-5,7H2.
What are the key properties of CID 59303846?
CID 59303846 has a molecular weight of 164.21 g/mol, XLogP of 0.50, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59303846 is sourced from PubChem (CID 59303846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).