C27H37ClN6O3Si — CID 170550447
tert-butyl-[2-[4-[6-chloro-4-methoxy-3-[1-(oxan-2-yl)pyrazol-4-yl]indol-1-yl]triazol-1-yl]ethoxy]-dimethylsilane (PubChem CID 170550447) has the molecular formula C27H37ClN6O3Si and a molecular weight of 557.17 g/mol. Its IUPAC name is tert-butyl-[2-[4-[6-chloro-4-methoxy-3-[1-(oxan-2-yl)pyrazol-4-yl]indol-1-yl]triazol-1-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[4-[6-chloro-4-methoxy-3-[1-(oxan-2-yl)pyrazol-4-yl]indol-1-yl]triazol-1-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 170550447 |
| Molecular Formula | C27H37ClN6O3Si |
| Molecular Weight | 557.17 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | tert-butyl-[2-[4-[6-chloro-4-methoxy-3-[1-(oxan-2-yl)pyrazol-4-yl]indol-1-yl]triazol-1-yl]ethoxy]-dimethylsilane |
| SMILES | COc1cc(Cl)cc2c1c(-c1cnn(C3CCCCO3)c1)cn2-c1cn(CCO[Si](C)(C)C(C)(C)C)nn1 |
| InChI | InChI=1S/C27H37ClN6O3Si/c1-27(2,3)38(5,6)37-12-10-32-18-24(30-31-32)33-17-21(26-22(33)13-20(28)14-23(26)35-4)19-15-29-34(16-19)25-9-7-8-11-36-25/h13-18,25H,7-12H2,1-6H3 |
| InChIKey | UBZPULMPHXRCBH-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 81.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.17 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|