C19H26ClIN4O2Si — CID 170550395
tert-butyl-[2-[4-(6-chloro-3-iodo-4-methoxyindol-1-yl)triazol-1-yl]ethoxy]-dimethylsilane (PubChem CID 170550395) has the molecular formula C19H26ClIN4O2Si and a molecular weight of 532.89 g/mol. Its IUPAC name is tert-butyl-[2-[4-(6-chloro-3-iodo-4-methoxyindol-1-yl)triazol-1-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[4-(6-chloro-3-iodo-4-methoxyindol-1-yl)triazol-1-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 170550395 |
| Molecular Formula | C19H26ClIN4O2Si |
| Molecular Weight | 532.89 g/mol |
| Exact Mass | 532.06 |
| IUPAC Name | tert-butyl-[2-[4-(6-chloro-3-iodo-4-methoxyindol-1-yl)triazol-1-yl]ethoxy]-dimethylsilane |
| SMILES | COc1cc(Cl)cc2c1c(I)cn2-c1cn(CCO[Si](C)(C)C(C)(C)C)nn1 |
| InChI | InChI=1S/C19H26ClIN4O2Si/c1-19(2,3)28(5,6)27-8-7-24-12-17(22-23-24)25-11-14(21)18-15(25)9-13(20)10-16(18)26-4/h9-12H,7-8H2,1-6H3 |
| InChIKey | CCMVBXLJPJPBMH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.89 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|