C20H25Cl2N5O2Si — CID 170550515
2-[1-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]triazol-4-yl]-6,7-dichloroindol-4-yl]oxyacetonitrile (PubChem CID 170550515) has the molecular formula C20H25Cl2N5O2Si and a molecular weight of 466.45 g/mol. Its IUPAC name is 2-[1-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]triazol-4-yl]-6,7-dichloroindol-4-yl]oxyacetonitrile.
| Compound Name | 2-[1-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]triazol-4-yl]-6,7-dichloroindol-4-yl]oxyacetonitrile |
|---|---|
| PubChem CID | 170550515 |
| Molecular Formula | C20H25Cl2N5O2Si |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 2-[1-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]triazol-4-yl]-6,7-dichloroindol-4-yl]oxyacetonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCCn1cc(-n2ccc3c(OCC#N)cc(Cl)c(Cl)c32)nn1 |
| InChI | InChI=1S/C20H25Cl2N5O2Si/c1-20(2,3)30(4,5)29-11-9-26-13-17(24-25-26)27-8-6-14-16(28-10-7-23)12-15(21)18(22)19(14)27/h6,8,12-13H,9-11H2,1-5H3 |
| InChIKey | UVFAVSDGPCNAOZ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 77.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|