C16H23Cl2NO2Si — CID 170550459
2-[(6,7-dichloro-4-ethoxyindol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 170550459) has the molecular formula C16H23Cl2NO2Si and a molecular weight of 360.36 g/mol. Its IUPAC name is 2-[(6,7-dichloro-4-ethoxyindol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(6,7-dichloro-4-ethoxyindol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 170550459 |
| Molecular Formula | C16H23Cl2NO2Si |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 2-[(6,7-dichloro-4-ethoxyindol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | CCOc1cc(Cl)c(Cl)c2c1ccn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C16H23Cl2NO2Si/c1-5-21-14-10-13(17)15(18)16-12(14)6-7-19(16)11-20-8-9-22(2,3)4/h6-7,10H,5,8-9,11H2,1-4H3 |
| InChIKey | IGOGZRCNEIDJGZ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|