C18H24Cl2N4O2Si — CID 170550480
1-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]triazol-4-yl]-6,7-dichloroindol-4-ol (PubChem CID 170550480) has the molecular formula C18H24Cl2N4O2Si and a molecular weight of 427.41 g/mol. Its IUPAC name is 1-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]triazol-4-yl]-6,7-dichloroindol-4-ol.
| Compound Name | 1-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]triazol-4-yl]-6,7-dichloroindol-4-ol |
|---|---|
| PubChem CID | 170550480 |
| Molecular Formula | C18H24Cl2N4O2Si |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 1-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]triazol-4-yl]-6,7-dichloroindol-4-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCn1cc(-n2ccc3c(O)cc(Cl)c(Cl)c32)nn1 |
| InChI | InChI=1S/C18H24Cl2N4O2Si/c1-18(2,3)27(4,5)26-9-8-23-11-15(21-22-23)24-7-6-12-14(25)10-13(19)16(20)17(12)24/h6-7,10-11,25H,8-9H2,1-5H3 |
| InChIKey | DJWXSYXRLHUTJQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|