C25H30Cl2N4O2Si — CID 170550512
tert-butyl-[2-[4-(6,7-dichloro-4-phenylmethoxyindol-1-yl)triazol-1-yl]ethoxy]-dimethylsilane (PubChem CID 170550512) has the molecular formula C25H30Cl2N4O2Si and a molecular weight of 517.53 g/mol. Its IUPAC name is tert-butyl-[2-[4-(6,7-dichloro-4-phenylmethoxyindol-1-yl)triazol-1-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[4-(6,7-dichloro-4-phenylmethoxyindol-1-yl)triazol-1-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 170550512 |
| Molecular Formula | C25H30Cl2N4O2Si |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | tert-butyl-[2-[4-(6,7-dichloro-4-phenylmethoxyindol-1-yl)triazol-1-yl]ethoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCn1cc(-n2ccc3c(OCc4ccccc4)cc(Cl)c(Cl)c32)nn1 |
| InChI | InChI=1S/C25H30Cl2N4O2Si/c1-25(2,3)34(4,5)33-14-13-30-16-22(28-29-30)31-12-11-19-21(15-20(26)23(27)24(19)31)32-17-18-9-7-6-8-10-18/h6-12,15-16H,13-14,17H2,1-5H3 |
| InChIKey | ALHLWGWBDASTLB-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|