C26H31Cl2NOSi — CID 170550472
2-(6,7-dichloro-4-phenylmethoxyindol-1-yl)ethynyl-tri(propan-2-yl)silane (PubChem CID 170550472) has the molecular formula C26H31Cl2NOSi and a molecular weight of 472.53 g/mol. Its IUPAC name is 2-(6,7-dichloro-4-phenylmethoxyindol-1-yl)ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-(6,7-dichloro-4-phenylmethoxyindol-1-yl)ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 170550472 |
| Molecular Formula | C26H31Cl2NOSi |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 2-(6,7-dichloro-4-phenylmethoxyindol-1-yl)ethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#Cn1ccc2c(OCc3ccccc3)cc(Cl)c(Cl)c21)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H31Cl2NOSi/c1-18(2)31(19(3)4,20(5)6)15-14-29-13-12-22-24(16-23(27)25(28)26(22)29)30-17-21-10-8-7-9-11-21/h7-13,16,18-20H,17H2,1-6H3 |
| InChIKey | RCOFVBHBMSJNAW-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|