About CID 175969492
CID 175969492 (PubChem CID 175969492) has the molecular formula C19H25ClIN4O2Si
and a molecular weight of 531.88 g/mol.
Molecular Properties
| Compound Name | CID 175969492 |
| PubChem CID | 175969492 |
| Molecular Formula | C19H25ClIN4O2Si |
| Molecular Weight | 531.88 g/mol |
| Exact Mass | 531.05 |
| IUPAC Name | — |
| SMILES | CCCCc1c(Cl)cc(OC)c2c(I)cn(-c3cn(CCO[Si](C)C)nn3)c12 |
| InChI | InChI=1S/C19H25ClIN4O2Si/c1-5-6-7-13-14(20)10-16(26-2)18-15(21)11-25(19(13)18)17-12-24(23-22-17)8-9-27-28(3)4/h10-12H,5-9H2,1-4H3 |
| InChIKey | SCZHLXKTEUGBKW-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 531.88 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 175969492 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175969492?
The IUPAC name of CID 175969492 (CID 175969492) is not available.
What is the SMILES notation for CID 175969492?
The canonical SMILES for CID 175969492 is CCCCc1c(Cl)cc(OC)c2c(I)cn(-c3cn(CCO[Si](C)C)nn3)c12.
What is the InChIKey of CID 175969492?
The InChIKey is SCZHLXKTEUGBKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25ClIN4O2Si/c1-5-6-7-13-14(20)10-16(26-2)18-15(21)11-25(19(13)18)17-12-24(23-22-17)8-9-27-28(3)4/h10-12H,5-9H2,1-4H3.
What are the key properties of CID 175969492?
CID 175969492 has a molecular weight of 531.88 g/mol, XLogP of 5.10, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175969492 is sourced from PubChem (CID 175969492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).