C19H22ClFN4O2Si — CID 170550383
2-[6-chloro-7-fluoro-3-imidazol-1-yl-1-(2-trimethylsilylethoxymethyl)indol-4-yl]oxyacetonitrile (PubChem CID 170550383) has the molecular formula C19H22ClFN4O2Si and a molecular weight of 420.95 g/mol. Its IUPAC name is 2-[6-chloro-7-fluoro-3-imidazol-1-yl-1-(2-trimethylsilylethoxymethyl)indol-4-yl]oxyacetonitrile.
| Compound Name | 2-[6-chloro-7-fluoro-3-imidazol-1-yl-1-(2-trimethylsilylethoxymethyl)indol-4-yl]oxyacetonitrile |
|---|---|
| PubChem CID | 170550383 |
| Molecular Formula | C19H22ClFN4O2Si |
| Molecular Weight | 420.95 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 2-[6-chloro-7-fluoro-3-imidazol-1-yl-1-(2-trimethylsilylethoxymethyl)indol-4-yl]oxyacetonitrile |
| SMILES | C[Si](C)(C)CCOCn1cc(-n2ccnc2)c2c(OCC#N)cc(Cl)c(F)c21 |
| InChI | InChI=1S/C19H22ClFN4O2Si/c1-28(2,3)9-8-26-13-25-11-15(24-6-5-23-12-24)17-16(27-7-4-22)10-14(20)18(21)19(17)25/h5-6,10-12H,7-9,13H2,1-3H3 |
| InChIKey | IRPJKMROXLYQGR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 65.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.95 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|