5,5-bis(prop-2-enyl)-4H-1,2-oxazole-3-carboxylic acid

C10H13NO3 — CID 170551040

IUPAC5,5-bis(prop-2-enyl)-4H-1,2-oxazole-3-carboxylic acid
SMILESC=CCC1(CC=C)CC(C(=O)O)=NO1
InChIInChI=1S/C10H13NO3/c1-3-5-10(6-4-2)7-8(9(12)13)11-14-10/h3-4H,1-2,5-7H2,(H,12,13)
InChIKeyBVGSCVVWCDLEJC-UHFFFAOYSA-N
MW195.22 g/mol
LogP1.74
Rot. Bonds5

About 5,5-bis(prop-2-enyl)-4H-1,2-oxazole-3-carboxylic acid

5,5-bis(prop-2-enyl)-4H-1,2-oxazole-3-carboxylic acid (PubChem CID 170551040) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 5,5-bis(prop-2-enyl)-4H-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5,5-bis(prop-2-enyl)-4H-1,2-oxazole-3-carboxylic acid
PubChem CID170551040
Molecular FormulaC10H13NO3
Molecular Weight195.22 g/mol
Exact Mass195.09
IUPAC Name5,5-bis(prop-2-enyl)-4H-1,2-oxazole-3-carboxylic acid
SMILESC=CCC1(CC=C)CC(C(=O)O)=NO1
InChIInChI=1S/C10H13NO3/c1-3-5-10(6-4-2)7-8(9(12)13)11-14-10/h3-4H,1-2,5-7H2,(H,12,13)
InChIKeyBVGSCVVWCDLEJC-UHFFFAOYSA-N
XLogP1.74
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.22
LogP ≤ 51.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 5,5-bis(prop-2-enyl)-4H-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,5-bis(prop-2-enyl)-4H-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5,5-bis(prop-2-enyl)-4H-1,2-oxazole-3-carboxylic acid (CID 170551040) is 5,5-bis(prop-2-enyl)-4H-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5,5-bis(prop-2-enyl)-4H-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5,5-bis(prop-2-enyl)-4H-1,2-oxazole-3-carboxylic acid is C=CCC1(CC=C)CC(C(=O)O)=NO1.
What is the InChIKey of 5,5-bis(prop-2-enyl)-4H-1,2-oxazole-3-carboxylic acid?
The InChIKey is BVGSCVVWCDLEJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c1-3-5-10(6-4-2)7-8(9(12)13)11-14-10/h3-4H,1-2,5-7H2,(H,12,13).
What are the key properties of 5,5-bis(prop-2-enyl)-4H-1,2-oxazole-3-carboxylic acid?
5,5-bis(prop-2-enyl)-4H-1,2-oxazole-3-carboxylic acid has a molecular weight of 195.22 g/mol, XLogP of 1.74, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-bis(prop-2-enyl)-4H-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 170551040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).