C10H13NO3 — CID 170551040
5,5-bis(prop-2-enyl)-4H-1,2-oxazole-3-carboxylic acid (PubChem CID 170551040) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 5,5-bis(prop-2-enyl)-4H-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5,5-bis(prop-2-enyl)-4H-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 170551040 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 5,5-bis(prop-2-enyl)-4H-1,2-oxazole-3-carboxylic acid |
| SMILES | C=CCC1(CC=C)CC(C(=O)O)=NO1 |
| InChI | InChI=1S/C10H13NO3/c1-3-5-10(6-4-2)7-8(9(12)13)11-14-10/h3-4H,1-2,5-7H2,(H,12,13) |
| InChIKey | BVGSCVVWCDLEJC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|