C24H46P2S — CID 170552528
(2,5-dibutyl-4-dipropylphosphanylthiophen-3-yl)-dipropylphosphane (PubChem CID 170552528) has the molecular formula C24H46P2S and a molecular weight of 428.65 g/mol. Its IUPAC name is (2,5-dibutyl-4-dipropylphosphanylthiophen-3-yl)-dipropylphosphane.
| Compound Name | (2,5-dibutyl-4-dipropylphosphanylthiophen-3-yl)-dipropylphosphane |
|---|---|
| PubChem CID | 170552528 |
| Molecular Formula | C24H46P2S |
| Molecular Weight | 428.65 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | (2,5-dibutyl-4-dipropylphosphanylthiophen-3-yl)-dipropylphosphane |
| SMILES | CCCCc1sc(CCCC)c(P(CCC)CCC)c1P(CCC)CCC |
| InChI | InChI=1S/C24H46P2S/c1-7-13-15-21-23(25(17-9-3)18-10-4)24(22(27-21)16-14-8-2)26(19-11-5)20-12-6/h7-20H2,1-6H3 |
| InChIKey | RQGVTGIJYVDOTK-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.65 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|