C12H7ClF3N — CID 170554263
3-chloro-5-(3,3,3-trifluoroprop-1-en-2-yl)isoquinoline (PubChem CID 170554263) has the molecular formula C12H7ClF3N and a molecular weight of 257.64 g/mol. Its IUPAC name is 3-chloro-5-(3,3,3-trifluoroprop-1-en-2-yl)isoquinoline.
| Compound Name | 3-chloro-5-(3,3,3-trifluoroprop-1-en-2-yl)isoquinoline |
|---|---|
| PubChem CID | 170554263 |
| Molecular Formula | C12H7ClF3N |
| Molecular Weight | 257.64 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 3-chloro-5-(3,3,3-trifluoroprop-1-en-2-yl)isoquinoline |
| SMILES | C=C(c1cccc2cnc(Cl)cc12)C(F)(F)F |
| InChI | InChI=1S/C12H7ClF3N/c1-7(12(14,15)16)9-4-2-3-8-6-17-11(13)5-10(8)9/h2-6H,1H2 |
| InChIKey | DLLMWSPOOKRGNS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.64 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|