C36H37N5O5 — CID 170554521
tert-butyl N-[2-[[4-[3-[6-(6-methoxy-3-pyridinyl)-4-methylquinazolin-8-yl]oxypropyl]benzoyl]amino]phenyl]carbamate (PubChem CID 170554521) has the molecular formula C36H37N5O5 and a molecular weight of 619.72 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-[3-[6-(6-methoxy-3-pyridinyl)-4-methylquinazolin-8-yl]oxypropyl]benzoyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-[3-[6-(6-methoxy-3-pyridinyl)-4-methylquinazolin-8-yl]oxypropyl]benzoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 170554521 |
| Molecular Formula | C36H37N5O5 |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.28 |
| IUPAC Name | tert-butyl N-[2-[[4-[3-[6-(6-methoxy-3-pyridinyl)-4-methylquinazolin-8-yl]oxypropyl]benzoyl]amino]phenyl]carbamate |
| SMILES | COc1ccc(-c2cc(OCCCc3ccc(C(=O)Nc4ccccc4NC(=O)OC(C)(C)C)cc3)c3ncnc(C)c3c2)cn1 |
| InChI | InChI=1S/C36H37N5O5/c1-23-28-19-27(26-16-17-32(44-5)37-21-26)20-31(33(28)39-22-38-23)45-18-8-9-24-12-14-25(15-13-24)34(42)40-29-10-6-7-11-30(29)41-35(43)46-36(2,3)4/h6-7,10-17,19-22H,8-9,18H2,1-5H3,(H,40,42)(H,41,43) |
| InChIKey | NJPSVBZSTQFELZ-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|