C36H30F2N6O6S — CID 175518847
8-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethoxy]-6-[5-(2,4-difluoro-N-sulfinoanilino)-6-methoxy-3-pyridinyl]-4-methylquinazoline (PubChem CID 175518847) has the molecular formula C36H30F2N6O6S and a molecular weight of 712.74 g/mol. Its IUPAC name is 8-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethoxy]-6-[5-(2,4-difluoro-N-sulfinoanilino)-6-methoxy-3-pyridinyl]-4-methylquinazoline.
| Compound Name | 8-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethoxy]-6-[5-(2,4-difluoro-N-sulfinoanilino)-6-methoxy-3-pyridinyl]-4-methylquinazoline |
|---|---|
| PubChem CID | 175518847 |
| Molecular Formula | C36H30F2N6O6S |
| Molecular Weight | 712.74 g/mol |
| Exact Mass | 712.19 |
| IUPAC Name | 8-[2-[4-[(2-aminophenyl)carbamoyl]phenoxy]ethoxy]-6-[5-(2,4-difluoro-N-sulfinoanilino)-6-methoxy-3-pyridinyl]-4-methylquinazoline |
| SMILES | COc1ncc(-c2cc(OCCOc3ccc(C(=O)Nc4ccccc4N)cc3)c3ncnc(C)c3c2)cc1N(c1ccc(F)cc1F)S(=O)O |
| InChI | InChI=1S/C36H30F2N6O6S/c1-21-27-15-23(24-16-32(36(48-2)40-19-24)44(51(46)47)31-12-9-25(37)18-28(31)38)17-33(34(27)42-20-41-21)50-14-13-49-26-10-7-22(8-11-26)35(45)43-30-6-4-3-5-29(30)39/h3-12,15-20H,13-14,39H2,1-2H3,(H,43,45)(H,46,47) |
| InChIKey | FDQHWLHODQBFRZ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 162.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.74 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|