C34H32F2N6O7S — CID 175518840
[2-[6-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]-4-methylquinazolin-8-yl]oxyhexanoylamino]phenyl] carbamate (PubChem CID 175518840) has the molecular formula C34H32F2N6O7S and a molecular weight of 706.73 g/mol. Its IUPAC name is [2-[6-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]-4-methylquinazolin-8-yl]oxyhexanoylamino]phenyl] carbamate.
| Compound Name | [2-[6-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]-4-methylquinazolin-8-yl]oxyhexanoylamino]phenyl] carbamate |
|---|---|
| PubChem CID | 175518840 |
| Molecular Formula | C34H32F2N6O7S |
| Molecular Weight | 706.73 g/mol |
| Exact Mass | 706.20 |
| IUPAC Name | [2-[6-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]-4-methylquinazolin-8-yl]oxyhexanoylamino]phenyl] carbamate |
| SMILES | COc1ncc(-c2cc(OCCCCCC(=O)Nc3ccccc3OC(N)=O)c3ncnc(C)c3c2)cc1NS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C34H32F2N6O7S/c1-20-24-14-21(22-15-27(33(47-2)38-18-22)42-50(45,46)30-12-11-23(35)17-25(30)36)16-29(32(24)40-19-39-20)48-13-7-3-4-10-31(43)41-26-8-5-6-9-28(26)49-34(37)44/h5-6,8-9,11-12,14-19,42H,3-4,7,10,13H2,1-2H3,(H2,37,44)(H,41,43) |
| InChIKey | QEUSFMHSVHUYIA-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 184.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.73 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|