C37H38F2N6O7S — CID 175518851
[2-[9-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]-4-methylquinazolin-8-yl]oxynonanoylamino]phenyl] carbamate (PubChem CID 175518851) has the molecular formula C37H38F2N6O7S and a molecular weight of 748.81 g/mol. Its IUPAC name is [2-[9-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]-4-methylquinazolin-8-yl]oxynonanoylamino]phenyl] carbamate.
| Compound Name | [2-[9-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]-4-methylquinazolin-8-yl]oxynonanoylamino]phenyl] carbamate |
|---|---|
| PubChem CID | 175518851 |
| Molecular Formula | C37H38F2N6O7S |
| Molecular Weight | 748.81 g/mol |
| Exact Mass | 748.25 |
| IUPAC Name | [2-[9-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]-4-methylquinazolin-8-yl]oxynonanoylamino]phenyl] carbamate |
| SMILES | COc1ncc(-c2cc(OCCCCCCCCC(=O)Nc3ccccc3OC(N)=O)c3ncnc(C)c3c2)cc1NS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C37H38F2N6O7S/c1-23-27-17-24(25-18-30(36(50-2)41-21-25)45-53(48,49)33-15-14-26(38)20-28(33)39)19-32(35(27)43-22-42-23)51-16-10-6-4-3-5-7-13-34(46)44-29-11-8-9-12-31(29)52-37(40)47/h8-9,11-12,14-15,17-22,45H,3-7,10,13,16H2,1-2H3,(H2,40,47)(H,44,46) |
| InChIKey | TZSOXDMQYZVTKH-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 184.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.81 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|