C33H32F2N6O5S — CID 170554560
N-(2-aminophenyl)-6-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]-4-methylquinazolin-8-yl]oxyhexanamide (PubChem CID 170554560) has the molecular formula C33H32F2N6O5S and a molecular weight of 662.72 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]-4-methylquinazolin-8-yl]oxyhexanamide.
| Compound Name | N-(2-aminophenyl)-6-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]-4-methylquinazolin-8-yl]oxyhexanamide |
|---|---|
| PubChem CID | 170554560 |
| Molecular Formula | C33H32F2N6O5S |
| Molecular Weight | 662.72 g/mol |
| Exact Mass | 662.21 |
| IUPAC Name | N-(2-aminophenyl)-6-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]-4-methylquinazolin-8-yl]oxyhexanamide |
| SMILES | COc1ncc(-c2cc(OCCCCCC(=O)Nc3ccccc3N)c3ncnc(C)c3c2)cc1NS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C33H32F2N6O5S/c1-20-24-14-21(22-15-28(33(45-2)37-18-22)41-47(43,44)30-12-11-23(34)17-25(30)35)16-29(32(24)39-19-38-20)46-13-7-3-4-10-31(42)40-27-9-6-5-8-26(27)36/h5-6,8-9,11-12,14-19,41H,3-4,7,10,13,36H2,1-2H3,(H,40,42) |
| InChIKey | MPDZOYAKHGBJDW-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 158.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.72 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|