C22H24F2N4O3S — CID 123172493
N-[5-[4-amino-3-(butylamino)phenyl]-2-methoxy-3-pyridinyl]-2,4-difluorobenzenesulfonamide (PubChem CID 123172493) has the molecular formula C22H24F2N4O3S and a molecular weight of 462.52 g/mol. Its IUPAC name is N-[5-[4-amino-3-(butylamino)phenyl]-2-methoxy-3-pyridinyl]-2,4-difluorobenzenesulfonamide.
| Compound Name | N-[5-[4-amino-3-(butylamino)phenyl]-2-methoxy-3-pyridinyl]-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 123172493 |
| Molecular Formula | C22H24F2N4O3S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | N-[5-[4-amino-3-(butylamino)phenyl]-2-methoxy-3-pyridinyl]-2,4-difluorobenzenesulfonamide |
| SMILES | CCCCNc1cc(-c2cnc(OC)c(NS(=O)(=O)c3ccc(F)cc3F)c2)ccc1N |
| InChI | InChI=1S/C22H24F2N4O3S/c1-3-4-9-26-19-10-14(5-7-18(19)25)15-11-20(22(31-2)27-13-15)28-32(29,30)21-8-6-16(23)12-17(21)24/h5-8,10-13,26,28H,3-4,9,25H2,1-2H3 |
| InChIKey | SYKOEDZZFJFLIX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|