C21H21F2IN4O3S — CID 89304055
N-[5-[4-amino-3-(3-iodopropylamino)phenyl]-2-methoxy-3-pyridinyl]-2,4-difluorobenzenesulfonamide (PubChem CID 89304055) has the molecular formula C21H21F2IN4O3S and a molecular weight of 574.39 g/mol. Its IUPAC name is N-[5-[4-amino-3-(3-iodopropylamino)phenyl]-2-methoxy-3-pyridinyl]-2,4-difluorobenzenesulfonamide.
| Compound Name | N-[5-[4-amino-3-(3-iodopropylamino)phenyl]-2-methoxy-3-pyridinyl]-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 89304055 |
| Molecular Formula | C21H21F2IN4O3S |
| Molecular Weight | 574.39 g/mol |
| Exact Mass | 574.03 |
| IUPAC Name | N-[5-[4-amino-3-(3-iodopropylamino)phenyl]-2-methoxy-3-pyridinyl]-2,4-difluorobenzenesulfonamide |
| SMILES | COc1ncc(-c2ccc(N)c(NCCCI)c2)cc1NS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H21F2IN4O3S/c1-31-21-19(28-32(29,30)20-6-4-15(22)11-16(20)23)10-14(12-27-21)13-3-5-17(25)18(9-13)26-8-2-7-24/h3-6,9-12,26,28H,2,7-8,25H2,1H3 |
| InChIKey | BEZXICIHNQQEOL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|