C29H23BrN4O5S — CID 175518906
[2-[[4-[2-(6-bromo-4-methylquinazolin-8-yl)oxyethoxy]benzoyl]amino]-4-thiophen-2-ylphenyl]carbamic acid (PubChem CID 175518906) has the molecular formula C29H23BrN4O5S and a molecular weight of 619.50 g/mol. Its IUPAC name is [2-[[4-[2-(6-bromo-4-methylquinazolin-8-yl)oxyethoxy]benzoyl]amino]-4-thiophen-2-ylphenyl]carbamic acid.
| Compound Name | [2-[[4-[2-(6-bromo-4-methylquinazolin-8-yl)oxyethoxy]benzoyl]amino]-4-thiophen-2-ylphenyl]carbamic acid |
|---|---|
| PubChem CID | 175518906 |
| Molecular Formula | C29H23BrN4O5S |
| Molecular Weight | 619.50 g/mol |
| Exact Mass | 618.06 |
| IUPAC Name | [2-[[4-[2-(6-bromo-4-methylquinazolin-8-yl)oxyethoxy]benzoyl]amino]-4-thiophen-2-ylphenyl]carbamic acid |
| SMILES | Cc1ncnc2c(OCCOc3ccc(C(=O)Nc4cc(-c5cccs5)ccc4NC(=O)O)cc3)cc(Br)cc12 |
| InChI | InChI=1S/C29H23BrN4O5S/c1-17-22-14-20(30)15-25(27(22)32-16-31-17)39-11-10-38-21-7-4-18(5-8-21)28(35)33-24-13-19(26-3-2-12-40-26)6-9-23(24)34-29(36)37/h2-9,12-16,34H,10-11H2,1H3,(H,33,35)(H,36,37) |
| InChIKey | DBGZZFLORCSHQE-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 122.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.50 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|