C19H17N3O6S2 — CID 69101070
[2-[(4-methoxybenzoyl)amino]-4-thiophen-2-ylphenyl]sulfamoylcarbamic acid (PubChem CID 69101070) has the molecular formula C19H17N3O6S2 and a molecular weight of 447.49 g/mol. Its IUPAC name is [2-[(4-methoxybenzoyl)amino]-4-thiophen-2-ylphenyl]sulfamoylcarbamic acid.
| Compound Name | [2-[(4-methoxybenzoyl)amino]-4-thiophen-2-ylphenyl]sulfamoylcarbamic acid |
|---|---|
| PubChem CID | 69101070 |
| Molecular Formula | C19H17N3O6S2 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | [2-[(4-methoxybenzoyl)amino]-4-thiophen-2-ylphenyl]sulfamoylcarbamic acid |
| SMILES | COc1ccc(C(=O)Nc2cc(-c3cccs3)ccc2NS(=O)(=O)NC(=O)O)cc1 |
| InChI | InChI=1S/C19H17N3O6S2/c1-28-14-7-4-12(5-8-14)18(23)20-16-11-13(17-3-2-10-29-17)6-9-15(16)21-30(26,27)22-19(24)25/h2-11,21-22H,1H3,(H,20,23)(H,24,25) |
| InChIKey | RZYWRNXNTDAHJO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |