C32H38NO7PSSe — CID 170556125
[4-(2-ethoxy-2-oxo-5-phenylselanyl-3,4-dihydro-1,2λ5-oxaphosphinin-6-yl)phenyl]methyl 4-(dipropylsulfamoyl)benzoate (PubChem CID 170556125) has the molecular formula C32H38NO7PSSe and a molecular weight of 690.66 g/mol. Its IUPAC name is [4-(2-ethoxy-2-oxo-5-phenylselanyl-3,4-dihydro-1,2λ5-oxaphosphinin-6-yl)phenyl]methyl 4-(dipropylsulfamoyl)benzoate.
| Compound Name | [4-(2-ethoxy-2-oxo-5-phenylselanyl-3,4-dihydro-1,2λ5-oxaphosphinin-6-yl)phenyl]methyl 4-(dipropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 170556125 |
| Molecular Formula | C32H38NO7PSSe |
| Molecular Weight | 690.66 g/mol |
| Exact Mass | 691.13 |
| IUPAC Name | [4-(2-ethoxy-2-oxo-5-phenylselanyl-3,4-dihydro-1,2λ5-oxaphosphinin-6-yl)phenyl]methyl 4-(dipropylsulfamoyl)benzoate |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)OCc2ccc(C3=C([Se]c4ccccc4)CCP(=O)(OCC)O3)cc2)cc1 |
| InChI | InChI=1S/C32H38NO7PSSe/c1-4-21-33(22-5-2)42(36,37)28-18-16-27(17-19-28)32(34)38-24-25-12-14-26(15-13-25)31-30(43-29-10-8-7-9-11-29)20-23-41(35,40-31)39-6-3/h7-19H,4-6,20-24H2,1-3H3 |
| InChIKey | LRJUKLZVXWPWJZ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.66 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|