About 3-(1-amino-2,2,2-trifluoroethyl)bicyclo[1.1.1]pentan-1-amine
3-(1-amino-2,2,2-trifluoroethyl)bicyclo[1.1.1]pentan-1-amine (PubChem CID 170557209) has the molecular formula C7H11F3N2
and a molecular weight of 180.17 g/mol. Its IUPAC name is 3-(1-amino-2,2,2-trifluoroethyl)bicyclo[1.1.1]pentan-1-amine.
Molecular Properties
| Compound Name | 3-(1-amino-2,2,2-trifluoroethyl)bicyclo[1.1.1]pentan-1-amine |
| PubChem CID | 170557209 |
| Molecular Formula | C7H11F3N2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 3-(1-amino-2,2,2-trifluoroethyl)bicyclo[1.1.1]pentan-1-amine |
| SMILES | NC(C(F)(F)F)C12CC(N)(C1)C2 |
| InChI | InChI=1S/C7H11F3N2/c8-7(9,10)4(11)5-1-6(12,2-5)3-5/h4H,1-3,11-12H2 |
| InChIKey | VENQMVODMQPGMD-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(1-amino-2,2,2-trifluoroethyl)bicyclo[1.1.1]pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-amino-2,2,2-trifluoroethyl)bicyclo[1.1.1]pentan-1-amine?
The IUPAC name of 3-(1-amino-2,2,2-trifluoroethyl)bicyclo[1.1.1]pentan-1-amine (CID 170557209) is 3-(1-amino-2,2,2-trifluoroethyl)bicyclo[1.1.1]pentan-1-amine.
What is the SMILES notation for 3-(1-amino-2,2,2-trifluoroethyl)bicyclo[1.1.1]pentan-1-amine?
The canonical SMILES for 3-(1-amino-2,2,2-trifluoroethyl)bicyclo[1.1.1]pentan-1-amine is NC(C(F)(F)F)C12CC(N)(C1)C2.
What is the InChIKey of 3-(1-amino-2,2,2-trifluoroethyl)bicyclo[1.1.1]pentan-1-amine?
The InChIKey is VENQMVODMQPGMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F3N2/c8-7(9,10)4(11)5-1-6(12,2-5)3-5/h4H,1-3,11-12H2.
What are the key properties of 3-(1-amino-2,2,2-trifluoroethyl)bicyclo[1.1.1]pentan-1-amine?
3-(1-amino-2,2,2-trifluoroethyl)bicyclo[1.1.1]pentan-1-amine has a molecular weight of 180.17 g/mol, XLogP of 0.76, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-amino-2,2,2-trifluoroethyl)bicyclo[1.1.1]pentan-1-amine is sourced from PubChem (CID 170557209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).