C22H20ClNO3 — CID 170558366
(E)-1-[2-chloro-3,5-bis(methoxymethyl)phenyl]-3-quinolin-3-ylprop-2-en-1-one (PubChem CID 170558366) has the molecular formula C22H20ClNO3 and a molecular weight of 381.86 g/mol. Its IUPAC name is (E)-1-[2-chloro-3,5-bis(methoxymethyl)phenyl]-3-quinolin-3-ylprop-2-en-1-one.
| Compound Name | (E)-1-[2-chloro-3,5-bis(methoxymethyl)phenyl]-3-quinolin-3-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 170558366 |
| Molecular Formula | C22H20ClNO3 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | (E)-1-[2-chloro-3,5-bis(methoxymethyl)phenyl]-3-quinolin-3-ylprop-2-en-1-one |
| SMILES | COCc1cc(COC)c(Cl)c(C(=O)/C=C/c2cnc3ccccc3c2)c1 |
| InChI | InChI=1S/C22H20ClNO3/c1-26-13-16-10-18(14-27-2)22(23)19(11-16)21(25)8-7-15-9-17-5-3-4-6-20(17)24-12-15/h3-12H,13-14H2,1-2H3/b8-7+ |
| InChIKey | LUXTYGHSCAHSFA-BQYQJAHWSA-N |
| XLogP | 5.08 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|