C10H22N2O2S4 — CID 170561493
4-[[[dimethylamino(sulfanyl)methyl]sulfanylmethylsulfanyl-sulfanylmethyl]-methylamino]butanoic acid (PubChem CID 170561493) has the molecular formula C10H22N2O2S4 and a molecular weight of 330.57 g/mol. Its IUPAC name is 4-[[[dimethylamino(sulfanyl)methyl]sulfanylmethylsulfanyl-sulfanylmethyl]-methylamino]butanoic acid.
| Compound Name | 4-[[[dimethylamino(sulfanyl)methyl]sulfanylmethylsulfanyl-sulfanylmethyl]-methylamino]butanoic acid |
|---|---|
| PubChem CID | 170561493 |
| Molecular Formula | C10H22N2O2S4 |
| Molecular Weight | 330.57 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 4-[[[dimethylamino(sulfanyl)methyl]sulfanylmethylsulfanyl-sulfanylmethyl]-methylamino]butanoic acid |
| SMILES | CN(C)C(S)SCSC(S)N(C)CCCC(=O)O |
| InChI | InChI=1S/C10H22N2O2S4/c1-11(2)9(15)17-7-18-10(16)12(3)6-4-5-8(13)14/h9-10,15-16H,4-7H2,1-3H3,(H,13,14) |
| InChIKey | IDNAXMZYMFZYPK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.57 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|