C18H17ClF6N2O6S2 — CID 170561747
bis(trifluoromethylsulfonyl)azanide;1-[3-[(3-chlorophenyl)methoxy]prop-1-en-2-yloxy]-4-methylpyridin-1-ium (PubChem CID 170561747) has the molecular formula C18H17ClF6N2O6S2 and a molecular weight of 570.92 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1-[3-[(3-chlorophenyl)methoxy]prop-1-en-2-yloxy]-4-methylpyridin-1-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1-[3-[(3-chlorophenyl)methoxy]prop-1-en-2-yloxy]-4-methylpyridin-1-ium |
|---|---|
| PubChem CID | 170561747 |
| Molecular Formula | C18H17ClF6N2O6S2 |
| Molecular Weight | 570.92 g/mol |
| Exact Mass | 570.01 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1-[3-[(3-chlorophenyl)methoxy]prop-1-en-2-yloxy]-4-methylpyridin-1-ium |
| SMILES | C=C(COCc1cccc(Cl)c1)O[n+]1ccc(C)cc1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H17ClNO2.C2F6NO4S2/c1-13-6-8-18(9-7-13)20-14(2)11-19-12-15-4-3-5-16(17)10-15;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-10H,2,11-12H2,1H3;/q+1;-1 |
| InChIKey | LWYUOARFULXKSV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 104.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.92 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|