C19H17ClF3N3O5S2 — CID 170563630
2-[(4-chlorophenyl)methylsulfinyl]-N-[3-(trifluoromethylsulfonylamino)propyl]-1,3-benzoxazole-5-carboxamide (PubChem CID 170563630) has the molecular formula C19H17ClF3N3O5S2 and a molecular weight of 523.94 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfinyl]-N-[3-(trifluoromethylsulfonylamino)propyl]-1,3-benzoxazole-5-carboxamide.
| Compound Name | 2-[(4-chlorophenyl)methylsulfinyl]-N-[3-(trifluoromethylsulfonylamino)propyl]-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 170563630 |
| Molecular Formula | C19H17ClF3N3O5S2 |
| Molecular Weight | 523.94 g/mol |
| Exact Mass | 523.03 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfinyl]-N-[3-(trifluoromethylsulfonylamino)propyl]-1,3-benzoxazole-5-carboxamide |
| SMILES | O=C(NCCCNS(=O)(=O)C(F)(F)F)c1ccc2oc(S(=O)Cc3ccc(Cl)cc3)nc2c1 |
| InChI | InChI=1S/C19H17ClF3N3O5S2/c20-14-5-2-12(3-6-14)11-32(28)18-26-15-10-13(4-7-16(15)31-18)17(27)24-8-1-9-25-33(29,30)19(21,22)23/h2-7,10,25H,1,8-9,11H2,(H,24,27) |
| InChIKey | CJRIODMZKXKJCI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.94 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|