C24H31N3O4S — CID 170563641
3-[2-(1H-indol-3-yl)ethylsulfamoyl]-4-methoxy-N,N-dipropylbenzamide (PubChem CID 170563641) has the molecular formula C24H31N3O4S and a molecular weight of 457.60 g/mol. Its IUPAC name is 3-[2-(1H-indol-3-yl)ethylsulfamoyl]-4-methoxy-N,N-dipropylbenzamide.
| Compound Name | 3-[2-(1H-indol-3-yl)ethylsulfamoyl]-4-methoxy-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 170563641 |
| Molecular Formula | C24H31N3O4S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 3-[2-(1H-indol-3-yl)ethylsulfamoyl]-4-methoxy-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(OC)c(S(=O)(=O)NCCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C24H31N3O4S/c1-4-14-27(15-5-2)24(28)18-10-11-22(31-3)23(16-18)32(29,30)26-13-12-19-17-25-21-9-7-6-8-20(19)21/h6-11,16-17,25-26H,4-5,12-15H2,1-3H3 |
| InChIKey | KJNCAZBMKNDXNC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |