C16H14N2O6 — CID 170564942
dimethyl 6-(6-methoxycarbonyl-2-pyridinyl)pyridine-2,4-dicarboxylate (PubChem CID 170564942) has the molecular formula C16H14N2O6 and a molecular weight of 330.30 g/mol. Its IUPAC name is dimethyl 6-(6-methoxycarbonyl-2-pyridinyl)pyridine-2,4-dicarboxylate.
| Compound Name | dimethyl 6-(6-methoxycarbonyl-2-pyridinyl)pyridine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 170564942 |
| Molecular Formula | C16H14N2O6 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | dimethyl 6-(6-methoxycarbonyl-2-pyridinyl)pyridine-2,4-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)nc(-c2cccc(C(=O)OC)n2)c1 |
| InChI | InChI=1S/C16H14N2O6/c1-22-14(19)9-7-12(18-13(8-9)16(21)24-3)10-5-4-6-11(17-10)15(20)23-2/h4-8H,1-3H3 |
| InChIKey | PKRLRQJPRDRELF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 104.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|