C33H32BrN — CID 170567721
3-(6-bromo-1,1,2,2,3,3-hexamethylinden-5-yl)-9-phenylcarbazole (PubChem CID 170567721) has the molecular formula C33H32BrN and a molecular weight of 522.53 g/mol. Its IUPAC name is 3-(6-bromo-1,1,2,2,3,3-hexamethylinden-5-yl)-9-phenylcarbazole.
| Compound Name | 3-(6-bromo-1,1,2,2,3,3-hexamethylinden-5-yl)-9-phenylcarbazole |
|---|---|
| PubChem CID | 170567721 |
| Molecular Formula | C33H32BrN |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 3-(6-bromo-1,1,2,2,3,3-hexamethylinden-5-yl)-9-phenylcarbazole |
| SMILES | CC1(C)c2cc(Br)c(-c3ccc4c(c3)c3ccccc3n4-c3ccccc3)cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C33H32BrN/c1-31(2)26-19-24(28(34)20-27(26)32(3,4)33(31,5)6)21-16-17-30-25(18-21)23-14-10-11-15-29(23)35(30)22-12-8-7-9-13-22/h7-20H,1-6H3 |
| InChIKey | WBNATVGGWBHFCK-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |