C51H44N2 — CID 177269832
3-[9-(1,1,2,2,3,3-hexamethyl-6-phenylinden-5-yl)carbazol-3-yl]-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole (PubChem CID 177269832) has the molecular formula C51H44N2 and a molecular weight of 689.96 g/mol. Its IUPAC name is 3-[9-(1,1,2,2,3,3-hexamethyl-6-phenylinden-5-yl)carbazol-3-yl]-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole.
| Compound Name | 3-[9-(1,1,2,2,3,3-hexamethyl-6-phenylinden-5-yl)carbazol-3-yl]-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
|---|---|
| PubChem CID | 177269832 |
| Molecular Formula | C51H44N2 |
| Molecular Weight | 689.96 g/mol |
| Exact Mass | 689.38 |
| IUPAC Name | 3-[9-(1,1,2,2,3,3-hexamethyl-6-phenylinden-5-yl)carbazol-3-yl]-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-n2c3ccccc3c3cc(-c4ccc5c(c4)c4ccccc4n5-c4cc5c(cc4-c4ccccc4)C(C)(C)C(C)(C)C5(C)C)ccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C51H44N2/c1-49(2)42-31-39(33-17-9-7-10-18-33)48(32-43(42)50(3,4)51(49,5)6)53-45-24-16-14-22-38(45)41-30-35(26-28-47(41)53)34-25-27-46-40(29-34)37-21-13-15-23-44(37)52(46)36-19-11-8-12-20-36/h7-32H,1-6H3/i8D,11D,12D,19D,20D |
| InChIKey | CCNRKOHUEDEORM-YUWQVECOSA-N |
| XLogP | 13.81 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.96 |
| LogP ≤ 5 | 13.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |