C16H19N5OS2 — CID 170573141
1-(4-tert-butyl-1,3-thiazol-2-yl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 170573141) has the molecular formula C16H19N5OS2 and a molecular weight of 361.50 g/mol. Its IUPAC name is 1-(4-tert-butyl-1,3-thiazol-2-yl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 170573141 |
| Molecular Formula | C16H19N5OS2 |
| Molecular Weight | 361.50 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(SC)nc2n1-c1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C16H19N5OS2/c1-6-7-20-13(22)10-8-17-14(23-5)19-12(10)21(20)15-18-11(9-24-15)16(2,3)4/h6,8-9H,1,7H2,2-5H3 |
| InChIKey | IIWMHTQZCBCLHS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|