C12H11N5OS2 — CID 153117694
6-methylsulfanyl-2-prop-2-enyl-1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 153117694) has the molecular formula C12H11N5OS2 and a molecular weight of 305.39 g/mol. Its IUPAC name is 6-methylsulfanyl-2-prop-2-enyl-1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 6-methylsulfanyl-2-prop-2-enyl-1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 153117694 |
| Molecular Formula | C12H11N5OS2 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 6-methylsulfanyl-2-prop-2-enyl-1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(SC)nc2n1-c1nccs1 |
| InChI | InChI=1S/C12H11N5OS2/c1-3-5-16-10(18)8-7-14-11(19-2)15-9(8)17(16)12-13-4-6-20-12/h3-4,6-7H,1,5H2,2H3 |
| InChIKey | VUFQGFIXCZZOKS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|