C25H37ClN6Sn — CID 170573605
N-(5-chloro-1-methylpyrazol-4-yl)-4-(6-tributylstannyl-2-pyridinyl)pyrimidin-2-amine (PubChem CID 170573605) has the molecular formula C25H37ClN6Sn and a molecular weight of 575.78 g/mol. Its IUPAC name is N-(5-chloro-1-methylpyrazol-4-yl)-4-(6-tributylstannyl-2-pyridinyl)pyrimidin-2-amine.
| Compound Name | N-(5-chloro-1-methylpyrazol-4-yl)-4-(6-tributylstannyl-2-pyridinyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 170573605 |
| Molecular Formula | C25H37ClN6Sn |
| Molecular Weight | 575.78 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | N-(5-chloro-1-methylpyrazol-4-yl)-4-(6-tributylstannyl-2-pyridinyl)pyrimidin-2-amine |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cccc(-c2ccnc(Nc3cnn(C)c3Cl)n2)n1 |
| InChI | InChI=1S/C13H10ClN6.3C4H9.Sn/c1-20-12(14)11(8-17-20)19-13-16-7-5-10(18-13)9-4-2-3-6-15-9;3*1-3-4-2;/h2-5,7-8H,1H3,(H,16,18,19);3*1,3-4H2,2H3; |
| InChIKey | SKKYPKBNHMDQMT-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.78 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |