C16H24N6O3 — CID 17057628
N-tert-butyl-2-[2-methoxy-6-[[(1-methyltetrazol-5-yl)amino]methyl]phenoxy]acetamide (PubChem CID 17057628) has the molecular formula C16H24N6O3 and a molecular weight of 348.41 g/mol. Its IUPAC name is N-tert-butyl-2-[2-methoxy-6-[[(1-methyltetrazol-5-yl)amino]methyl]phenoxy]acetamide.
| Compound Name | N-tert-butyl-2-[2-methoxy-6-[[(1-methyltetrazol-5-yl)amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 17057628 |
| Molecular Formula | C16H24N6O3 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | N-tert-butyl-2-[2-methoxy-6-[[(1-methyltetrazol-5-yl)amino]methyl]phenoxy]acetamide |
| SMILES | COc1cccc(CNc2nnnn2C)c1OCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H24N6O3/c1-16(2,3)18-13(23)10-25-14-11(7-6-8-12(14)24-5)9-17-15-19-20-21-22(15)4/h6-8H,9-10H2,1-5H3,(H,18,23)(H,17,19,21) |
| InChIKey | QSCQSZHRAFRMHV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |