C17H25ClN4O — CID 170580069
(Z)-4-amino-3-[amino(methyl)amino]-N-[(3-chlorophenyl)-cyclopentylmethyl]but-3-enamide (PubChem CID 170580069) has the molecular formula C17H25ClN4O and a molecular weight of 336.87 g/mol. Its IUPAC name is (Z)-4-amino-3-[amino(methyl)amino]-N-[(3-chlorophenyl)-cyclopentylmethyl]but-3-enamide.
| Compound Name | (Z)-4-amino-3-[amino(methyl)amino]-N-[(3-chlorophenyl)-cyclopentylmethyl]but-3-enamide |
|---|---|
| PubChem CID | 170580069 |
| Molecular Formula | C17H25ClN4O |
| Molecular Weight | 336.87 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | (Z)-4-amino-3-[amino(methyl)amino]-N-[(3-chlorophenyl)-cyclopentylmethyl]but-3-enamide |
| SMILES | CN(N)/C(=C\N)CC(=O)NC(c1cccc(Cl)c1)C1CCCC1 |
| InChI | InChI=1S/C17H25ClN4O/c1-22(20)15(11-19)10-16(23)21-17(12-5-2-3-6-12)13-7-4-8-14(18)9-13/h4,7-9,11-12,17H,2-3,5-6,10,19-20H2,1H3,(H,21,23)/b15-11- |
| InChIKey | ACYDBGIMVHUSPL-PTNGSMBKSA-N |
| XLogP | 2.68 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.87 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|