C17H22ClN5O — CID 170580171
N-[(S)-(3-chlorophenyl)-cyclopentylmethyl]-4-(tetrazol-1-yl)butanamide (PubChem CID 170580171) has the molecular formula C17H22ClN5O and a molecular weight of 347.85 g/mol. Its IUPAC name is N-[(S)-(3-chlorophenyl)-cyclopentylmethyl]-4-(tetrazol-1-yl)butanamide.
| Compound Name | N-[(S)-(3-chlorophenyl)-cyclopentylmethyl]-4-(tetrazol-1-yl)butanamide |
|---|---|
| PubChem CID | 170580171 |
| Molecular Formula | C17H22ClN5O |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-[(S)-(3-chlorophenyl)-cyclopentylmethyl]-4-(tetrazol-1-yl)butanamide |
| SMILES | O=C(CCCn1cnnn1)N[C@H](c1cccc(Cl)c1)C1CCCC1 |
| InChI | InChI=1S/C17H22ClN5O/c18-15-8-3-7-14(11-15)17(13-5-1-2-6-13)20-16(24)9-4-10-23-12-19-21-22-23/h3,7-8,11-13,17H,1-2,4-6,9-10H2,(H,20,24)/t17-/m0/s1 |
| InChIKey | APNCAQFFDKELNV-KRWDZBQOSA-N |
| XLogP | 3.15 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |