C24H28ClF2N3O2 — CID 170581089
N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]formamide;N-cyclobutyl-2-pyridin-3-ylacetamide (PubChem CID 170581089) has the molecular formula C24H28ClF2N3O2 and a molecular weight of 463.96 g/mol. Its IUPAC name is N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]formamide;N-cyclobutyl-2-pyridin-3-ylacetamide.
| Compound Name | N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]formamide;N-cyclobutyl-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 170581089 |
| Molecular Formula | C24H28ClF2N3O2 |
| Molecular Weight | 463.96 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]formamide;N-cyclobutyl-2-pyridin-3-ylacetamide |
| SMILES | O=C(Cc1cccnc1)NC1CCC1.O=CNC(c1c(F)ccc(Cl)c1F)C1CCCC1 |
| InChI | InChI=1S/C13H14ClF2NO.C11H14N2O/c14-9-5-6-10(15)11(12(9)16)13(17-7-18)8-3-1-2-4-8;14-11(13-10-4-1-5-10)7-9-3-2-6-12-8-9/h5-8,13H,1-4H2,(H,17,18);2-3,6,8,10H,1,4-5,7H2,(H,13,14) |
| InChIKey | QTQLTUJEZKIDQV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.96 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|