C18H22ClF2NO — CID 170578853
N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide (PubChem CID 170578853) has the molecular formula C18H22ClF2NO and a molecular weight of 341.83 g/mol. Its IUPAC name is N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide.
| Compound Name | N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 170578853 |
| Molecular Formula | C18H22ClF2NO |
| Molecular Weight | 341.83 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide |
| SMILES | O=C(NC(c1c(F)ccc(Cl)c1F)C1CCCC1)C1CCCC1 |
| InChI | InChI=1S/C18H22ClF2NO/c19-13-9-10-14(20)15(16(13)21)17(11-5-1-2-6-11)22-18(23)12-7-3-4-8-12/h9-12,17H,1-8H2,(H,22,23) |
| InChIKey | KXKZEAOJBYAIAJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.83 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|