C19H26ClF2N3O2 — CID 170579094
N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]-3-(ethylcarbamoylamino)-2-methylpropanamide (PubChem CID 170579094) has the molecular formula C19H26ClF2N3O2 and a molecular weight of 401.89 g/mol. Its IUPAC name is N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]-3-(ethylcarbamoylamino)-2-methylpropanamide.
| Compound Name | N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]-3-(ethylcarbamoylamino)-2-methylpropanamide |
|---|---|
| PubChem CID | 170579094 |
| Molecular Formula | C19H26ClF2N3O2 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]-3-(ethylcarbamoylamino)-2-methylpropanamide |
| SMILES | CCNC(=O)NCC(C)C(=O)NC(c1c(F)ccc(Cl)c1F)C1CCCC1 |
| InChI | InChI=1S/C19H26ClF2N3O2/c1-3-23-19(27)24-10-11(2)18(26)25-17(12-6-4-5-7-12)15-14(21)9-8-13(20)16(15)22/h8-9,11-12,17H,3-7,10H2,1-2H3,(H,25,26)(H2,23,24,27) |
| InChIKey | IGROSKZXMRMPEM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|