C19H23ClF2N2O — CID 170580331
N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide;formonitrile (PubChem CID 170580331) has the molecular formula C19H23ClF2N2O and a molecular weight of 368.86 g/mol. Its IUPAC name is N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide;formonitrile.
| Compound Name | N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide;formonitrile |
|---|---|
| PubChem CID | 170580331 |
| Molecular Formula | C19H23ClF2N2O |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide;formonitrile |
| SMILES | C#N.O=C(NC(c1c(F)ccc(Cl)c1F)C1CCCC1)C1CCCC1 |
| InChI | InChI=1S/C18H22ClF2NO.CHN/c19-13-9-10-14(20)15(16(13)21)17(11-5-1-2-6-11)22-18(23)12-7-3-4-8-12;1-2/h9-12,17H,1-8H2,(H,22,23);1H |
| InChIKey | UJAUHKCWTYKTHE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|