C19H22Cl2F3NO — CID 170580433
N-[(2,3-dichloro-6-fluorophenyl)-[1-(difluoromethyl)cyclopentyl]methyl]cyclopentanecarboxamide (PubChem CID 170580433) has the molecular formula C19H22Cl2F3NO and a molecular weight of 408.29 g/mol. Its IUPAC name is N-[(2,3-dichloro-6-fluorophenyl)-[1-(difluoromethyl)cyclopentyl]methyl]cyclopentanecarboxamide.
| Compound Name | N-[(2,3-dichloro-6-fluorophenyl)-[1-(difluoromethyl)cyclopentyl]methyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 170580433 |
| Molecular Formula | C19H22Cl2F3NO |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | N-[(2,3-dichloro-6-fluorophenyl)-[1-(difluoromethyl)cyclopentyl]methyl]cyclopentanecarboxamide |
| SMILES | O=C(NC(c1c(F)ccc(Cl)c1Cl)C1(C(F)F)CCCC1)C1CCCC1 |
| InChI | InChI=1S/C19H22Cl2F3NO/c20-12-7-8-13(22)14(15(12)21)16(19(18(23)24)9-3-4-10-19)25-17(26)11-5-1-2-6-11/h7-8,11,16,18H,1-6,9-10H2,(H,25,26) |
| InChIKey | AMQVBHVRSIZCDV-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|