C21H27Cl2FN2O2 — CID 170579105
N-[(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide (PubChem CID 170579105) has the molecular formula C21H27Cl2FN2O2 and a molecular weight of 429.36 g/mol. Its IUPAC name is N-[(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide.
| Compound Name | N-[(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 170579105 |
| Molecular Formula | C21H27Cl2FN2O2 |
| Molecular Weight | 429.36 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | N-[(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide |
| SMILES | CC(C)N1CC(C(=O)NC(c2c(F)ccc(Cl)c2Cl)C2(C)CCCC2)CC1=O |
| InChI | InChI=1S/C21H27Cl2FN2O2/c1-12(2)26-11-13(10-16(26)27)20(28)25-19(21(3)8-4-5-9-21)17-15(24)7-6-14(22)18(17)23/h6-7,12-13,19H,4-5,8-11H2,1-3H3,(H,25,28) |
| InChIKey | USSOFHYOOSUBNQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.36 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|