C21H28Cl2FN3O2 — CID 170330453
3-acetamido-4-amino-N-[(S)-(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]cyclopentane-1-carboxamide (PubChem CID 170330453) has the molecular formula C21H28Cl2FN3O2 and a molecular weight of 444.38 g/mol. Its IUPAC name is 3-acetamido-4-amino-N-[(S)-(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]cyclopentane-1-carboxamide.
| Compound Name | 3-acetamido-4-amino-N-[(S)-(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 170330453 |
| Molecular Formula | C21H28Cl2FN3O2 |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 3-acetamido-4-amino-N-[(S)-(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]cyclopentane-1-carboxamide |
| SMILES | CC(=O)NC1CC(C(=O)N[C@H](c2c(F)ccc(Cl)c2Cl)C2(C)CCCC2)CC1N |
| InChI | InChI=1S/C21H28Cl2FN3O2/c1-11(28)26-16-10-12(9-15(16)25)20(29)27-19(21(2)7-3-4-8-21)17-14(24)6-5-13(22)18(17)23/h5-6,12,15-16,19H,3-4,7-10,25H2,1-2H3,(H,26,28)(H,27,29)/t12?,15?,16?,19-/m1/s1 |
| InChIKey | HQYUNIIEVSINPG-KGKWDUAPSA-N |
| XLogP | 4.11 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|