C19H25Cl2FN2O — CID 170330440
trans-(1R,3R)-3-amino-N-[(R)-(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]cyclopentane-1-carboxamide (PubChem CID 170330440) has the molecular formula C19H25Cl2FN2O and a molecular weight of 387.33 g/mol. Its IUPAC name is trans-(1R,3R)-3-amino-N-[(R)-(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]cyclopentane-1-carboxamide.
| Compound Name | trans-(1R,3R)-3-amino-N-[(R)-(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 170330440 |
| Molecular Formula | C19H25Cl2FN2O |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | trans-(1R,3R)-3-amino-N-[(R)-(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]cyclopentane-1-carboxamide |
| SMILES | CC1([C@@H](NC(=O)[C@@H]2CC[C@@H](N)C2)c2c(F)ccc(Cl)c2Cl)CCCC1 |
| InChI | InChI=1S/C19H25Cl2FN2O/c1-19(8-2-3-9-19)17(15-14(22)7-6-13(20)16(15)21)24-18(25)11-4-5-12(23)10-11/h6-7,11-12,17H,2-5,8-10,23H2,1H3,(H,24,25)/t11-,12-,17+/m1/s1 |
| InChIKey | OZYZABCNLBBRQW-QFSBIZTOSA-N |
| XLogP | 5.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|