C24H28Cl2FN3O3S — CID 170580737
N-[(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]-1-(pyridin-3-ylmethylsulfonyl)pyrrolidine-3-carboxamide (PubChem CID 170580737) has the molecular formula C24H28Cl2FN3O3S and a molecular weight of 528.48 g/mol. Its IUPAC name is N-[(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]-1-(pyridin-3-ylmethylsulfonyl)pyrrolidine-3-carboxamide.
| Compound Name | N-[(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]-1-(pyridin-3-ylmethylsulfonyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 170580737 |
| Molecular Formula | C24H28Cl2FN3O3S |
| Molecular Weight | 528.48 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | N-[(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]-1-(pyridin-3-ylmethylsulfonyl)pyrrolidine-3-carboxamide |
| SMILES | CC1(C(NC(=O)C2CCN(S(=O)(=O)Cc3cccnc3)C2)c2c(F)ccc(Cl)c2Cl)CCCC1 |
| InChI | InChI=1S/C24H28Cl2FN3O3S/c1-24(9-2-3-10-24)22(20-19(27)7-6-18(25)21(20)26)29-23(31)17-8-12-30(14-17)34(32,33)15-16-5-4-11-28-13-16/h4-7,11,13,17,22H,2-3,8-10,12,14-15H2,1H3,(H,29,31) |
| InChIKey | YJYISANFWKVKLG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|